C23H30FN3O5S — CID 54632143
2-fluoro-N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide (PubChem CID 54632143) has the molecular formula C23H30FN3O5S and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-fluoro-N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54632143 |
| Molecular Formula | C23H30FN3O5S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-fluoro-N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
| SMILES | CO[C@H]1CN(C)C(=O)c2ccc(NS(=O)(=O)c3ccccc3F)cc2OC[C@@H](C)NC[C@@H]1C |
| InChI | InChI=1S/C23H30FN3O5S/c1-15-12-25-16(2)14-32-20-11-17(26-33(29,30)22-8-6-5-7-19(22)24)9-10-18(20)23(28)27(3)13-21(15)31-4/h5-11,15-16,21,25-26H,12-14H2,1-4H3/t15-,16+,21-/m0/s1 |
| InChIKey | DHNAZJFKQHWVTC-MRUHUIDDSA-N |
| XLogP | 2.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |