C23H30ClN3O5S — CID 54633819
4-chloro-N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide (PubChem CID 54633819) has the molecular formula C23H30ClN3O5S and a molecular weight of 496.03 g/mol. Its IUPAC name is 4-chloro-N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54633819 |
| Molecular Formula | C23H30ClN3O5S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 4-chloro-N-[(4S,7R,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2OC[C@H](C)NC[C@H]1C |
| InChI | InChI=1S/C23H30ClN3O5S/c1-15-12-25-16(2)14-32-21-11-18(26-33(29,30)19-8-5-17(24)6-9-19)7-10-20(21)23(28)27(3)13-22(15)31-4/h5-11,15-16,22,25-26H,12-14H2,1-4H3/t15-,16+,22-/m1/s1 |
| InChIKey | JZMVFBXUMGVJNA-ZMPRRUGASA-N |
| XLogP | 3.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |