C24H37N3O4 — CID 54632281
N-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclohexanecarboxamide (PubChem CID 54632281) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclohexanecarboxamide.
| Compound Name | N-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 54632281 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | N-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclohexanecarboxamide |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NC(=O)C3CCCCC3)ccc2OC[C@H](C)NC[C@@H]1C |
| InChI | InChI=1S/C24H37N3O4/c1-16-13-25-17(2)15-31-21-11-10-19(26-23(28)18-8-6-5-7-9-18)12-20(21)24(29)27(3)14-22(16)30-4/h10-12,16-18,22,25H,5-9,13-15H2,1-4H3,(H,26,28)/t16-,17-,22-/m0/s1 |
| InChIKey | WWIWLTDSUPVNED-HOIFWPIMSA-N |
| XLogP | 3.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |