C29H45N3O4 — CID 54637294
N-[(4S,7R,8S)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclobutanecarboxamide (PubChem CID 54637294) has the molecular formula C29H45N3O4 and a molecular weight of 499.70 g/mol. Its IUPAC name is N-[(4S,7R,8S)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclobutanecarboxamide.
| Compound Name | N-[(4S,7R,8S)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 54637294 |
| Molecular Formula | C29H45N3O4 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | N-[(4S,7R,8S)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]cyclobutanecarboxamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2cc(NC(=O)C3CCC3)ccc2OC[C@H](C)N(CC2CCCCC2)C[C@H]1C |
| InChI | InChI=1S/C29H45N3O4/c1-20-16-32(17-22-9-6-5-7-10-22)21(2)19-36-26-14-13-24(30-28(33)23-11-8-12-23)15-25(26)29(34)31(3)18-27(20)35-4/h13-15,20-23,27H,5-12,16-19H2,1-4H3,(H,30,33)/t20-,21+,27-/m1/s1 |
| InChIKey | QSOWRIJEXJJTJS-PBDKAQRYSA-N |
| XLogP | 4.81 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |