C27H42N4O4 — CID 71759821
1-cyclopentyl-3-[(4S,7R,8R)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea (PubChem CID 71759821) has the molecular formula C27H42N4O4 and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(4S,7R,8R)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea.
| Compound Name | 1-cyclopentyl-3-[(4S,7R,8R)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea |
|---|---|
| PubChem CID | 71759821 |
| Molecular Formula | C27H42N4O4 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 1-cyclopentyl-3-[(4S,7R,8R)-5-(cyclopropylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NC(=O)NC3CCCC3)ccc2OC[C@H](C)N(CC2CC2)C[C@H]1C |
| InChI | InChI=1S/C27H42N4O4/c1-18-14-31(15-20-9-10-20)19(2)17-35-24-12-11-22(29-27(33)28-21-7-5-6-8-21)13-23(24)26(32)30(3)16-25(18)34-4/h11-13,18-21,25H,5-10,14-17H2,1-4H3,(H2,28,29,33)/t18-,19+,25+/m1/s1 |
| InChIKey | JOLNEHFVMQQSOB-WYEJZRMESA-N |
| XLogP | 3.97 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |