C25H33ClN4O4 — CID 54632296
1-(4-chlorophenyl)-3-[(4S,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea (PubChem CID 54632296) has the molecular formula C25H33ClN4O4 and a molecular weight of 489.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4S,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4S,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea |
|---|---|
| PubChem CID | 54632296 |
| Molecular Formula | C25H33ClN4O4 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4S,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea |
| SMILES | CO[C@@H]1CN(C)C(=O)c2cc(NC(=O)Nc3ccc(Cl)cc3)ccc2OC[C@H](C)N(C)C[C@@H]1C |
| InChI | InChI=1S/C25H33ClN4O4/c1-16-13-29(3)17(2)15-34-22-11-10-20(12-21(22)24(31)30(4)14-23(16)33-5)28-25(32)27-19-8-6-18(26)7-9-19/h6-12,16-17,23H,13-15H2,1-5H3,(H2,27,28,32)/t16-,17-,23+/m0/s1 |
| InChIKey | UTSKQZKBDSTIJA-HKARXFIJSA-N |
| XLogP | 4.42 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |