C25H32F2N4O4 — CID 54635100
1-(2,5-difluorophenyl)-3-[(4R,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea (PubChem CID 54635100) has the molecular formula C25H32F2N4O4 and a molecular weight of 490.55 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[(4R,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[(4R,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea |
|---|---|
| PubChem CID | 54635100 |
| Molecular Formula | C25H32F2N4O4 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[(4R,7S,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]urea |
| SMILES | CO[C@@H]1CN(C)C(=O)c2cc(NC(=O)Nc3cc(F)ccc3F)ccc2OC[C@@H](C)N(C)C[C@@H]1C |
| InChI | InChI=1S/C25H32F2N4O4/c1-15-12-30(3)16(2)14-35-22-9-7-18(11-19(22)24(32)31(4)13-23(15)34-5)28-25(33)29-21-10-17(26)6-8-20(21)27/h6-11,15-16,23H,12-14H2,1-5H3,(H2,28,29,33)/t15-,16+,23+/m0/s1 |
| InChIKey | HVHQVBJDPAEICM-NXHTTZLHSA-N |
| XLogP | 4.04 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |