C29H36N4O5S — CID 54632726
N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-3-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide (PubChem CID 54632726) has the molecular formula C29H36N4O5S and a molecular weight of 552.70 g/mol. Its IUPAC name is N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-3-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide.
| Compound Name | N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-3-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54632726 |
| Molecular Formula | C29H36N4O5S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-3-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
| SMILES | CO[C@H]1CN(C)C(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2OC[C@@H](C)N(Cc2cccnc2)C[C@H]1C |
| InChI | InChI=1S/C29H36N4O5S/c1-21-17-33(18-23-9-8-14-30-16-23)22(2)20-38-27-15-24(31-39(35,36)25-10-6-5-7-11-25)12-13-26(27)29(34)32(3)19-28(21)37-4/h5-16,21-22,28,31H,17-20H2,1-4H3/t21-,22-,28+/m1/s1 |
| InChIKey | SLSVJKSFTBBFSH-XJGOYTCSSA-N |
| XLogP | 3.89 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |