C24H33N3O5S — CID 54633710
N-[(4R,7R,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide (PubChem CID 54633710) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[(4R,7R,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide.
| Compound Name | N-[(4R,7R,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54633710 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[(4R,7R,8S)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]benzenesulfonamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2OC[C@@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C24H33N3O5S/c1-17-14-26(3)18(2)16-32-22-13-19(25-33(29,30)20-9-7-6-8-10-20)11-12-21(22)24(28)27(4)15-23(17)31-5/h6-13,17-18,23,25H,14-16H2,1-5H3/t17-,18-,23-/m1/s1 |
| InChIKey | KVPJAUDUDGITLT-PMAPCBKXSA-N |
| XLogP | 2.92 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |