C22H33N5O5S — CID 54635480
N-[(4R,7R,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1-methylimidazole-4-sulfonamide (PubChem CID 54635480) has the molecular formula C22H33N5O5S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-[(4R,7R,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[(4R,7R,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 54635480 |
| Molecular Formula | C22H33N5O5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-[(4R,7R,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1-methylimidazole-4-sulfonamide |
| SMILES | CO[C@H]1CN(C)C(=O)c2ccc(NS(=O)(=O)c3cn(C)cn3)cc2OC[C@@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C22H33N5O5S/c1-15-10-26(4)16(2)13-32-19-9-17(24-33(29,30)21-12-25(3)14-23-21)7-8-18(19)22(28)27(5)11-20(15)31-6/h7-9,12,14-16,20,24H,10-11,13H2,1-6H3/t15-,16-,20+/m1/s1 |
| InChIKey | UXKGTUVSNNFLJT-QINHECLXSA-N |
| XLogP | 1.66 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |