C20H30F3N3O5S — CID 54634400
2,2,2-trifluoro-N-[(4R,7S,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide (PubChem CID 54634400) has the molecular formula C20H30F3N3O5S and a molecular weight of 481.54 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4R,7S,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[(4R,7S,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 54634400 |
| Molecular Formula | C20H30F3N3O5S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4R,7S,8R)-8-methoxy-4,5,7,10-tetramethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NS(=O)(=O)CC(F)(F)F)ccc2OC[C@@H](C)N(C)C[C@@H]1C |
| InChI | InChI=1S/C20H30F3N3O5S/c1-13-9-25(3)14(2)11-31-17-7-6-15(24-32(28,29)12-20(21,22)23)8-16(17)19(27)26(4)10-18(13)30-5/h6-8,13-14,18,24H,9-12H2,1-5H3/t13-,14+,18-/m0/s1 |
| InChIKey | NAKUAOPJLXDQOX-IYOUNJFTSA-N |
| XLogP | 2.43 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |