C26H34N4O5 — CID 54635474
N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide (PubChem CID 54635474) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide.
| Compound Name | N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide |
|---|---|
| PubChem CID | 54635474 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc2c(c1)C(=O)N(C)C[C@H](OC)[C@H](C)CN(C(=O)c1ccncc1)[C@@H](C)CO2 |
| InChI | InChI=1S/C26H34N4O5/c1-6-24(31)28-20-7-8-22-21(13-20)26(33)29(4)15-23(34-5)17(2)14-30(18(3)16-35-22)25(32)19-9-11-27-12-10-19/h7-13,17-18,23H,6,14-16H2,1-5H3,(H,28,31)/t17-,18+,23+/m1/s1 |
| InChIKey | GWCWPZHEBBSOFV-STSQHVNTSA-N |
| XLogP | 3.08 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |