C27H36N4O5 — CID 54635614
N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide (PubChem CID 54635614) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide.
| Compound Name | N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide |
|---|---|
| PubChem CID | 54635614 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridine-4-carbonyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)OC[C@H](C)N(C(=O)c1ccncc1)C[C@@H](C)[C@@H](OC)CN(C)C2=O |
| InChI | InChI=1S/C27H36N4O5/c1-6-7-25(32)29-21-8-9-22-23(14-21)36-17-19(3)31(26(33)20-10-12-28-13-11-20)15-18(2)24(35-5)16-30(4)27(22)34/h8-14,18-19,24H,6-7,15-17H2,1-5H3,(H,29,32)/t18-,19+,24+/m1/s1 |
| InChIKey | YWXSVTHBRJTWKV-IMWIBFENSA-N |
| XLogP | 3.47 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |