C28H39N3O4 — CID 54635488
N-[(4R,7R,8R)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide (PubChem CID 54635488) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-[(4R,7R,8R)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide.
| Compound Name | N-[(4R,7R,8R)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide |
|---|---|
| PubChem CID | 54635488 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | N-[(4R,7R,8R)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)OC[C@@H](C)N(Cc1ccccc1)C[C@@H](C)[C@@H](OC)CN(C)C2=O |
| InChI | InChI=1S/C28H39N3O4/c1-6-10-27(32)29-23-13-14-24-25(15-23)35-19-21(3)31(17-22-11-8-7-9-12-22)16-20(2)26(34-5)18-30(4)28(24)33/h7-9,11-15,20-21,26H,6,10,16-19H2,1-5H3,(H,29,32)/t20-,21-,26+/m1/s1 |
| InChIKey | KMNVMWYFKSTSRQ-YPCDYVTLSA-N |
| XLogP | 4.43 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |