C28H38FN3O4 — CID 54636595
N-[(4S,7S,8S)-5-[(3-fluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide (PubChem CID 54636595) has the molecular formula C28H38FN3O4 and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[(4S,7S,8S)-5-[(3-fluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide.
| Compound Name | N-[(4S,7S,8S)-5-[(3-fluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide |
|---|---|
| PubChem CID | 54636595 |
| Molecular Formula | C28H38FN3O4 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | N-[(4S,7S,8S)-5-[(3-fluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)OC[C@H](C)N(Cc1cccc(F)c1)C[C@H](C)[C@H](OC)CN(C)C2=O |
| InChI | InChI=1S/C28H38FN3O4/c1-6-8-27(33)30-23-11-12-24-25(14-23)36-18-20(3)32(16-21-9-7-10-22(29)13-21)15-19(2)26(35-5)17-31(4)28(24)34/h7,9-14,19-20,26H,6,8,15-18H2,1-5H3,(H,30,33)/t19-,20-,26+/m0/s1 |
| InChIKey | HSUTUXIRAOUEMZ-CUVVAGTFSA-N |
| XLogP | 4.57 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |