C31H41N3O5 — CID 54635523
N-[(4S,7R,8S)-5-benzoyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]cyclohexanecarboxamide (PubChem CID 54635523) has the molecular formula C31H41N3O5 and a molecular weight of 535.69 g/mol. Its IUPAC name is N-[(4S,7R,8S)-5-benzoyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]cyclohexanecarboxamide.
| Compound Name | N-[(4S,7R,8S)-5-benzoyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 54635523 |
| Molecular Formula | C31H41N3O5 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | N-[(4S,7R,8S)-5-benzoyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]cyclohexanecarboxamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NC(=O)C3CCCCC3)cc2OC[C@H](C)N(C(=O)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C31H41N3O5/c1-21-18-34(30(36)24-13-9-6-10-14-24)22(2)20-39-27-17-25(32-29(35)23-11-7-5-8-12-23)15-16-26(27)31(37)33(3)19-28(21)38-4/h6,9-10,13-17,21-23,28H,5,7-8,11-12,18-20H2,1-4H3,(H,32,35)/t21-,22+,28-/m1/s1 |
| InChIKey | RAHZBASTSBOCJS-RZIGYZOXSA-N |
| XLogP | 4.85 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |