C26H39N3O5 — CID 54637427
N-[(4R,7R,8S)-5-(cyclohexanecarbonyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]acetamide (PubChem CID 54637427) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is N-[(4R,7R,8S)-5-(cyclohexanecarbonyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]acetamide.
| Compound Name | N-[(4R,7R,8S)-5-(cyclohexanecarbonyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]acetamide |
|---|---|
| PubChem CID | 54637427 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | N-[(4R,7R,8S)-5-(cyclohexanecarbonyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]acetamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NC(C)=O)cc2OC[C@@H](C)N(C(=O)C2CCCCC2)C[C@H]1C |
| InChI | InChI=1S/C26H39N3O5/c1-17-14-29(25(31)20-9-7-6-8-10-20)18(2)16-34-23-13-21(27-19(3)30)11-12-22(23)26(32)28(4)15-24(17)33-5/h11-13,17-18,20,24H,6-10,14-16H2,1-5H3,(H,27,30)/t17-,18-,24-/m1/s1 |
| InChIKey | FDVAQTVKGLKQFL-QZTZHPFYSA-N |
| XLogP | 3.56 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |