C28H39N3O5 — CID 54636105
N-[(4S,7R,8S)-8-methoxy-5-[(2-methoxyphenyl)methyl]-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]propanamide (PubChem CID 54636105) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[(4S,7R,8S)-8-methoxy-5-[(2-methoxyphenyl)methyl]-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]propanamide.
| Compound Name | N-[(4S,7R,8S)-8-methoxy-5-[(2-methoxyphenyl)methyl]-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]propanamide |
|---|---|
| PubChem CID | 54636105 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | N-[(4S,7R,8S)-8-methoxy-5-[(2-methoxyphenyl)methyl]-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc2c(c1)OC[C@H](C)N(Cc1ccccc1OC)C[C@@H](C)[C@H](OC)CN(C)C2=O |
| InChI | InChI=1S/C28H39N3O5/c1-7-27(32)29-22-12-13-23-25(14-22)36-18-20(3)31(16-21-10-8-9-11-24(21)34-5)15-19(2)26(35-6)17-30(4)28(23)33/h8-14,19-20,26H,7,15-18H2,1-6H3,(H,29,32)/t19-,20+,26-/m1/s1 |
| InChIKey | KSGMCQNGSPAWRQ-BVFVYWQFSA-N |
| XLogP | 4.05 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |