C33H42N4O4 — CID 54636782
N-[(4S,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-pyridin-2-ylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]butanamide (PubChem CID 54636782) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is N-[(4S,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-pyridin-2-ylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]butanamide.
| Compound Name | N-[(4S,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-pyridin-2-ylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]butanamide |
|---|---|
| PubChem CID | 54636782 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | N-[(4S,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-pyridin-2-ylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C(=O)N(C)C[C@@H](OC)[C@@H](C)CN(Cc1ccc(-c3ccccn3)cc1)[C@@H](C)CO2 |
| InChI | InChI=1S/C33H42N4O4/c1-6-9-32(38)35-27-15-16-30-28(18-27)33(39)36(4)21-31(40-5)23(2)19-37(24(3)22-41-30)20-25-11-13-26(14-12-25)29-10-7-8-17-34-29/h7-8,10-18,23-24,31H,6,9,19-22H2,1-5H3,(H,35,38)/t23-,24-,31+/m0/s1 |
| InChIKey | DKFJGYQTLBOWCX-ISTJGCCRSA-N |
| XLogP | 5.49 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |