C32H36N4O4S — CID 54636788
N-[(4R,7R,8S)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1,3-benzothiazole-2-carboxamide (PubChem CID 54636788) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is N-[(4R,7R,8S)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[(4R,7R,8S)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 54636788 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | N-[(4R,7R,8S)-5-benzyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-1,3-benzothiazole-2-carboxamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2ccc(NC(=O)c3nc4ccccc4s3)cc2OC[C@@H](C)N(Cc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C32H36N4O4S/c1-21-17-36(18-23-10-6-5-7-11-23)22(2)20-40-27-16-24(14-15-25(27)32(38)35(3)19-28(21)39-4)33-30(37)31-34-26-12-8-9-13-29(26)41-31/h5-16,21-22,28H,17-20H2,1-4H3,(H,33,37)/t21-,22-,28-/m1/s1 |
| InChIKey | YJCJPPNKEWBJHB-DQCZWYHMSA-N |
| XLogP | 5.55 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |