C27H43N3O5 — CID 54637111
N-[(4R,7S,8R)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-2-methoxyacetamide (PubChem CID 54637111) has the molecular formula C27H43N3O5 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-[(4R,7S,8R)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-2-methoxyacetamide.
| Compound Name | N-[(4R,7S,8R)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 54637111 |
| Molecular Formula | C27H43N3O5 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | N-[(4R,7S,8R)-5-(cyclohexylmethyl)-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-15-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc2c(c1)OC[C@@H](C)N(CC1CCCCC1)C[C@H](C)[C@@H](OC)CN(C)C2=O |
| InChI | InChI=1S/C27H43N3O5/c1-19-14-30(15-21-9-7-6-8-10-21)20(2)17-35-24-13-22(28-26(31)18-33-4)11-12-23(24)27(32)29(3)16-25(19)34-5/h11-13,19-21,25H,6-10,14-18H2,1-5H3,(H,28,31)/t19-,20+,25-/m0/s1 |
| InChIKey | SNFNJZCGXQPRKL-DFIYOIEZSA-N |
| XLogP | 3.66 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |