C16H23NO4 — CID 5463785
6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl 2-methylprop-2-enoate (PubChem CID 5463785) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl 2-methylprop-2-enoate.
| Compound Name | 6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 5463785 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCN1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C16H23NO4/c1-11(2)16(20)21-10-8-6-5-7-9-17-14(18)12(3)13(4)15(17)19/h1,5-10H2,2-4H3 |
| InChIKey | SGONPVYGYALKRZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|