C15H21NO4 — CID 19352853
6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl prop-2-enoate (PubChem CID 19352853) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl prop-2-enoate.
| Compound Name | 6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl prop-2-enoate |
|---|---|
| PubChem CID | 19352853 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCN1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C15H21NO4/c1-4-13(17)20-10-8-6-5-7-9-16-14(18)11(2)12(3)15(16)19/h4H,1,5-10H2,2-3H3 |
| InChIKey | NAZFGHLLJRSQEE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|