C15H19NO4 — CID 58545249
[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexyl] prop-2-enoate (PubChem CID 58545249) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is [4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexyl] prop-2-enoate.
| Compound Name | [4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 58545249 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(N2C(=O)C(C)=C(C)C2=O)CC1 |
| InChI | InChI=1S/C15H19NO4/c1-4-13(17)20-12-7-5-11(6-8-12)16-14(18)9(2)10(3)15(16)19/h4,11-12H,1,5-8H2,2-3H3 |
| InChIKey | LMLOWYAPRJQUJT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|