About CID 5463794
CID 5463794 (PubChem CID 5463794) has the molecular formula C8H17O
and a molecular weight of 129.22 g/mol.
Molecular Properties
| Compound Name | CID 5463794 |
| PubChem CID | 5463794 |
| Molecular Formula | C8H17O |
| Molecular Weight | 129.22 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)C[O] |
| InChI | InChI=1S/C8H17O/c1-3-5-6-8(4-2)7-9/h8H,3-7H2,1-2H3 |
| InChIKey | VWZKHKRVSXWHAC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 5463794 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5463794?
The IUPAC name of CID 5463794 (CID 5463794) is not available.
What is the SMILES notation for CID 5463794?
The canonical SMILES for CID 5463794 is CCCCC(CC)C[O].
What is the InChIKey of CID 5463794?
The InChIKey is VWZKHKRVSXWHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O/c1-3-5-6-8(4-2)7-9/h8H,3-7H2,1-2H3.
What are the key properties of CID 5463794?
CID 5463794 has a molecular weight of 129.22 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5463794 is sourced from PubChem (CID 5463794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).