C20H33N3O5 — CID 54639234
N-[(2S,3R,6R)-2-(hydroxymethyl)-6-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]cyclobutanecarboxamide (PubChem CID 54639234) has the molecular formula C20H33N3O5 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(2S,3R,6R)-2-(hydroxymethyl)-6-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]cyclobutanecarboxamide.
| Compound Name | N-[(2S,3R,6R)-2-(hydroxymethyl)-6-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 54639234 |
| Molecular Formula | C20H33N3O5 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[(2S,3R,6R)-2-(hydroxymethyl)-6-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]cyclobutanecarboxamide |
| SMILES | O=C(C[C@@H]1C=C[C@@H](NC(=O)C2CCC2)[C@@H](CO)O1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C20H33N3O5/c24-14-18-17(22-20(26)15-3-1-4-15)6-5-16(28-18)13-19(25)21-7-2-8-23-9-11-27-12-10-23/h5-6,15-18,24H,1-4,7-14H2,(H,21,25)(H,22,26)/t16-,17+,18+/m0/s1 |
| InChIKey | AGYKQGZRDSIEQP-RCCFBDPRSA-N |
| XLogP | -0.18 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|