C22H32N4O5 — CID 54640032
2-[(2R,3R,6R)-2-(hydroxymethyl)-3-[(2-pyridin-2-ylacetyl)amino]-3,6-dihydro-2H-pyran-6-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 54640032) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[(2R,3R,6R)-2-(hydroxymethyl)-3-[(2-pyridin-2-ylacetyl)amino]-3,6-dihydro-2H-pyran-6-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[(2R,3R,6R)-2-(hydroxymethyl)-3-[(2-pyridin-2-ylacetyl)amino]-3,6-dihydro-2H-pyran-6-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 54640032 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[(2R,3R,6R)-2-(hydroxymethyl)-3-[(2-pyridin-2-ylacetyl)amino]-3,6-dihydro-2H-pyran-6-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(C[C@@H]1C=C[C@@H](NC(=O)Cc2ccccn2)[C@H](CO)O1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C22H32N4O5/c27-16-20-19(25-22(29)14-17-4-1-2-7-23-17)6-5-18(31-20)15-21(28)24-8-3-9-26-10-12-30-13-11-26/h1-2,4-7,18-20,27H,3,8-16H2,(H,24,28)(H,25,29)/t18-,19+,20-/m0/s1 |
| InChIKey | JNAWISBSOJGFKT-ZCNNSNEGSA-N |
| XLogP | -0.35 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|