C21H26Cl2N4O5 — CID 54641134
N-[(3,4-dichlorophenyl)methyl]-2-[(2S,5S,6S)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide (PubChem CID 54641134) has the molecular formula C21H26Cl2N4O5 and a molecular weight of 485.37 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-[(2S,5S,6S)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-[(2S,5S,6S)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 54641134 |
| Molecular Formula | C21H26Cl2N4O5 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-[(2S,5S,6S)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)carbamoylamino]-6-(hydroxymethyl)oxan-2-yl]acetamide |
| SMILES | Cc1noc(C)c1NC(=O)N[C@H]1CC[C@@H](CC(=O)NCc2ccc(Cl)c(Cl)c2)O[C@@H]1CO |
| InChI | InChI=1S/C21H26Cl2N4O5/c1-11-20(12(2)32-27-11)26-21(30)25-17-6-4-14(31-18(17)10-28)8-19(29)24-9-13-3-5-15(22)16(23)7-13/h3,5,7,14,17-18,28H,4,6,8-10H2,1-2H3,(H,24,29)(H2,25,26,30)/t14-,17-,18+/m0/s1 |
| InChIKey | PLXQZJRBLQQGKU-JCGIZDLHSA-N |
| XLogP | 3.33 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |