C16H21FN2O5S — CID 54641241
N-ethyl-2-[(2R,3S,6R)-3-[(4-fluorophenyl)sulfonylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide (PubChem CID 54641241) has the molecular formula C16H21FN2O5S and a molecular weight of 372.42 g/mol. Its IUPAC name is N-ethyl-2-[(2R,3S,6R)-3-[(4-fluorophenyl)sulfonylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide.
| Compound Name | N-ethyl-2-[(2R,3S,6R)-3-[(4-fluorophenyl)sulfonylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide |
|---|---|
| PubChem CID | 54641241 |
| Molecular Formula | C16H21FN2O5S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-ethyl-2-[(2R,3S,6R)-3-[(4-fluorophenyl)sulfonylamino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetamide |
| SMILES | CCNC(=O)C[C@@H]1C=C[C@H](NS(=O)(=O)c2ccc(F)cc2)[C@H](CO)O1 |
| InChI | InChI=1S/C16H21FN2O5S/c1-2-18-16(21)9-12-5-8-14(15(10-20)24-12)19-25(22,23)13-6-3-11(17)4-7-13/h3-8,12,14-15,19-20H,2,9-10H2,1H3,(H,18,21)/t12-,14-,15-/m0/s1 |
| InChIKey | UOWXRGDLFUDMAF-QEJZJMRPSA-N |
| XLogP | 0.31 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|