C15H19NO7S — CID 54642564
2-[(2R,3R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)sulfonylamino]-3,6-dihydro-2H-pyran-6-yl]acetic acid (PubChem CID 54642564) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-[(2R,3R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)sulfonylamino]-3,6-dihydro-2H-pyran-6-yl]acetic acid.
| Compound Name | 2-[(2R,3R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)sulfonylamino]-3,6-dihydro-2H-pyran-6-yl]acetic acid |
|---|---|
| PubChem CID | 54642564 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[(2R,3R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)sulfonylamino]-3,6-dihydro-2H-pyran-6-yl]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H]2C=C[C@H](CC(=O)O)O[C@H]2CO)cc1 |
| InChI | InChI=1S/C15H19NO7S/c1-22-10-2-5-12(6-3-10)24(20,21)16-13-7-4-11(8-15(18)19)23-14(13)9-17/h2-7,11,13-14,16-17H,8-9H2,1H3,(H,18,19)/t11-,13-,14+/m1/s1 |
| InChIKey | CKPAPQIIXSLJFJ-BNOWGMLFSA-N |
| XLogP | 0.13 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|