C19H29N5O5 — CID 54643775
1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(2S,3R,6S)-2-(hydroxymethyl)-6-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]urea (PubChem CID 54643775) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(2S,3R,6S)-2-(hydroxymethyl)-6-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]urea.
| Compound Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(2S,3R,6S)-2-(hydroxymethyl)-6-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]urea |
|---|---|
| PubChem CID | 54643775 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(2S,3R,6S)-2-(hydroxymethyl)-6-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,6-dihydro-2H-pyran-3-yl]urea |
| SMILES | Cc1noc(C)c1NC(=O)N[C@@H]1C=C[C@H](CC(=O)N2CCN(C)CC2)O[C@@H]1CO |
| InChI | InChI=1S/C19H29N5O5/c1-12-18(13(2)29-22-12)21-19(27)20-15-5-4-14(28-16(15)11-25)10-17(26)24-8-6-23(3)7-9-24/h4-5,14-16,25H,6-11H2,1-3H3,(H2,20,21,27)/t14-,15-,16-/m1/s1 |
| InChIKey | QKJIXQBKLPFZFO-BZUAXINKSA-N |
| XLogP | 0.26 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|