C21H27NO7 — CID 54646012
methyl 2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-(oxane-4-carbonylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate (PubChem CID 54646012) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-(oxane-4-carbonylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate.
| Compound Name | methyl 2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-(oxane-4-carbonylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 54646012 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | methyl 2-[(1R,3S,4aS,9aR)-1-(hydroxymethyl)-6-(oxane-4-carbonylamino)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H]2c3cc(NC(=O)C4CCOCC4)ccc3O[C@H]2[C@@H](CO)O1 |
| InChI | InChI=1S/C21H27NO7/c1-26-19(24)10-14-9-16-15-8-13(22-21(25)12-4-6-27-7-5-12)2-3-17(15)29-20(16)18(11-23)28-14/h2-3,8,12,14,16,18,20,23H,4-7,9-11H2,1H3,(H,22,25)/t14-,16-,18+,20+/m0/s1 |
| InChIKey | CYYYAXPAVULRAL-LBLLVPRASA-N |
| XLogP | 1.61 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |