C13H24N2O3 — CID 546472
tert-butyl 2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate (PubChem CID 546472) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 546472 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl 2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
| SMILES | CN1C(=O)CN(C(=O)OC(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C13H24N2O3/c1-12(2,3)10-14(7)9(16)8-15(10)11(17)18-13(4,5)6/h10H,8H2,1-7H3 |
| InChIKey | HJJLVATZPPJBNG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |