C23H23F3N2O6 — CID 54647577
methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[[4-(trifluoromethyl)phenyl]carbamoylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate (PubChem CID 54647577) has the molecular formula C23H23F3N2O6 and a molecular weight of 480.44 g/mol. Its IUPAC name is methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[[4-(trifluoromethyl)phenyl]carbamoylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate.
| Compound Name | methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[[4-(trifluoromethyl)phenyl]carbamoylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 54647577 |
| Molecular Formula | C23H23F3N2O6 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | methyl 2-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-6-[[4-(trifluoromethyl)phenyl]carbamoylamino]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H]2c3cc(NC(=O)Nc4ccc(C(F)(F)F)cc4)ccc3O[C@H]2[C@H](CO)O1 |
| InChI | InChI=1S/C23H23F3N2O6/c1-32-20(30)10-15-9-17-16-8-14(6-7-18(16)34-21(17)19(11-29)33-15)28-22(31)27-13-4-2-12(3-5-13)23(24,25)26/h2-8,15,17,19,21,29H,9-11H2,1H3,(H2,27,28,31)/t15-,17-,19-,21+/m0/s1 |
| InChIKey | MSQUSFAFSKSPPL-WRGRXTPVSA-N |
| XLogP | 3.91 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |