C22H25FN2O6S — CID 54648143
2-[(1R,3R,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N,N-dimethylacetamide (PubChem CID 54648143) has the molecular formula C22H25FN2O6S and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[(1R,3R,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(1R,3R,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 54648143 |
| Molecular Formula | C22H25FN2O6S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[(1R,3R,4aR,9aS)-6-[(4-fluorophenyl)sulfonylamino]-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-3-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C[C@H]1C[C@@H]2c3cc(NS(=O)(=O)c4ccc(F)cc4)ccc3O[C@@H]2[C@@H](CO)O1 |
| InChI | InChI=1S/C22H25FN2O6S/c1-25(2)21(27)11-15-10-18-17-9-14(5-8-19(17)31-22(18)20(12-26)30-15)24-32(28,29)16-6-3-13(23)4-7-16/h3-9,15,18,20,22,24,26H,10-12H2,1-2H3/t15-,18-,20-,22+/m1/s1 |
| InChIKey | BBGNEXOMHSTGIT-HBPKQZLHSA-N |
| XLogP | 2.10 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |