C26H31FN4O5 — CID 54648172
1-[(1S,3S,4aR,9aS)-1-(hydroxymethyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea (PubChem CID 54648172) has the molecular formula C26H31FN4O5 and a molecular weight of 498.56 g/mol. Its IUPAC name is 1-[(1S,3S,4aR,9aS)-1-(hydroxymethyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(1S,3S,4aR,9aS)-1-(hydroxymethyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 54648172 |
| Molecular Formula | C26H31FN4O5 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1-[(1S,3S,4aR,9aS)-1-(hydroxymethyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea |
| SMILES | CN1CCN(C(=O)C[C@@H]2C[C@@H]3c4cc(NC(=O)Nc5ccccc5F)ccc4O[C@@H]3[C@H](CO)O2)CC1 |
| InChI | InChI=1S/C26H31FN4O5/c1-30-8-10-31(11-9-30)24(33)14-17-13-19-18-12-16(6-7-22(18)36-25(19)23(15-32)35-17)28-26(34)29-21-5-3-2-4-20(21)27/h2-7,12,17,19,23,25,32H,8-11,13-15H2,1H3,(H2,28,29,34)/t17-,19+,23-,25-/m0/s1 |
| InChIKey | VLPDSNLVMNITGA-VEROOCSVSA-N |
| XLogP | 2.63 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |