C26H30FN3O5 — CID 54648463
1-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea (PubChem CID 54648463) has the molecular formula C26H30FN3O5 and a molecular weight of 483.54 g/mol. Its IUPAC name is 1-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 54648463 |
| Molecular Formula | C26H30FN3O5 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-[(1S,3S,4aS,9aR)-1-(hydroxymethyl)-3-(2-oxo-2-piperidin-1-ylethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b][1]benzofuran-6-yl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc2c(c1)[C@@H]1C[C@@H](CC(=O)N3CCCCC3)O[C@@H](CO)[C@@H]1O2)Nc1ccccc1F |
| InChI | InChI=1S/C26H30FN3O5/c27-20-6-2-3-7-21(20)29-26(33)28-16-8-9-22-18(12-16)19-13-17(34-23(15-31)25(19)35-22)14-24(32)30-10-4-1-5-11-30/h2-3,6-9,12,17,19,23,25,31H,1,4-5,10-11,13-15H2,(H2,28,29,33)/t17-,19-,23-,25+/m0/s1 |
| InChIKey | FFPQCQKYNLBSFI-CKRMUJODSA-N |
| XLogP | 3.87 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |