C18H19N3O2 — CID 54653035
[(1S,2aR,8bR)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-2-yl]-pyridin-2-ylmethanone (PubChem CID 54653035) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is [(1S,2aR,8bR)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-2-yl]-pyridin-2-ylmethanone.
| Compound Name | [(1S,2aR,8bR)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-2-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 54653035 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [(1S,2aR,8bR)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-2-yl]-pyridin-2-ylmethanone |
| SMILES | CN1C[C@H]2[C@@H](c3ccccc31)[C@@H](CO)N2C(=O)c1ccccn1 |
| InChI | InChI=1S/C18H19N3O2/c1-20-10-15-17(12-6-2-3-8-14(12)20)16(11-22)21(15)18(23)13-7-4-5-9-19-13/h2-9,15-17,22H,10-11H2,1H3/t15-,16+,17+/m0/s1 |
| InChIKey | WCINXDGGQRWIST-GVDBMIGSSA-N |
| XLogP | 1.50 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |