C19H20ClN3O2 — CID 54652793
(1S,2aR,8bR)-N-(2-chlorophenyl)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-2-carboxamide (PubChem CID 54652793) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is (1S,2aR,8bR)-N-(2-chlorophenyl)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-2-carboxamide.
| Compound Name | (1S,2aR,8bR)-N-(2-chlorophenyl)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 54652793 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (1S,2aR,8bR)-N-(2-chlorophenyl)-1-(hydroxymethyl)-4-methyl-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-2-carboxamide |
| SMILES | CN1C[C@H]2[C@@H](c3ccccc31)[C@@H](CO)N2C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H20ClN3O2/c1-22-10-16-18(12-6-2-5-9-15(12)22)17(11-24)23(16)19(25)21-14-8-4-3-7-13(14)20/h2-9,16-18,24H,10-11H2,1H3,(H,21,25)/t16-,17+,18+/m0/s1 |
| InChIKey | FPDNDFIICFJGNT-RCCFBDPRSA-N |
| XLogP | 3.15 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |