C25H23Cl2N3O2 — CID 54653522
(1S,2aR,8bR)-N-(3-chlorophenyl)-2-[(2-chlorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide (PubChem CID 54653522) has the molecular formula C25H23Cl2N3O2 and a molecular weight of 468.38 g/mol. Its IUPAC name is (1S,2aR,8bR)-N-(3-chlorophenyl)-2-[(2-chlorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide.
| Compound Name | (1S,2aR,8bR)-N-(3-chlorophenyl)-2-[(2-chlorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 54653522 |
| Molecular Formula | C25H23Cl2N3O2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (1S,2aR,8bR)-N-(3-chlorophenyl)-2-[(2-chlorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1C[C@H]2[C@@H](c3ccccc31)[C@@H](CO)N2Cc1ccccc1Cl |
| InChI | InChI=1S/C25H23Cl2N3O2/c26-17-7-5-8-18(12-17)28-25(32)30-14-22-24(19-9-2-4-11-21(19)30)23(15-31)29(22)13-16-6-1-3-10-20(16)27/h1-12,22-24,31H,13-15H2,(H,28,32)/t22-,23+,24+/m0/s1 |
| InChIKey | KTXAFKNPGNZLPC-RBZQAINGSA-N |
| XLogP | 5.37 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |