C26H25FN2O3 — CID 54653322
[(1R,2aS,8bS)-2-[(2-fluorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-(3-methoxyphenyl)methanone (PubChem CID 54653322) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is [(1R,2aS,8bS)-2-[(2-fluorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(1R,2aS,8bS)-2-[(2-fluorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 54653322 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(1R,2aS,8bS)-2-[(2-fluorophenyl)methyl]-1-(hydroxymethyl)-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2C[C@@H]3[C@H](c4ccccc42)[C@H](CO)N3Cc2ccccc2F)c1 |
| InChI | InChI=1S/C26H25FN2O3/c1-32-19-9-6-8-17(13-19)26(31)29-15-23-25(20-10-3-5-12-22(20)29)24(16-30)28(23)14-18-7-2-4-11-21(18)27/h2-13,23-25,30H,14-16H2,1H3/t23-,24+,25+/m1/s1 |
| InChIKey | HOUNTBOUHWREHQ-DSITVLBTSA-N |
| XLogP | 3.82 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |