C26H26FN3O3 — CID 54652567
(1S,2aR,8bR)-N-(4-fluorophenyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide (PubChem CID 54652567) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is (1S,2aR,8bR)-N-(4-fluorophenyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide.
| Compound Name | (1S,2aR,8bR)-N-(4-fluorophenyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 54652567 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (1S,2aR,8bR)-N-(4-fluorophenyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinoline-4-carboxamide |
| SMILES | COc1ccc(CN2[C@H](CO)[C@@H]3c4ccccc4N(C(=O)Nc4ccc(F)cc4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C26H26FN3O3/c1-33-20-12-6-17(7-13-20)14-29-23-15-30(26(32)28-19-10-8-18(27)9-11-19)22-5-3-2-4-21(22)25(23)24(29)16-31/h2-13,23-25,31H,14-16H2,1H3,(H,28,32)/t23-,24+,25+/m0/s1 |
| InChIKey | FQKXBUVFPMCKHZ-ISJGIBHGSA-N |
| XLogP | 4.22 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |