C22H23F3N2O3 — CID 54653365
1-[(1R,2aS,8bS)-1-(hydroxymethyl)-2-[(3-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 54653365) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 1-[(1R,2aS,8bS)-1-(hydroxymethyl)-2-[(3-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[(1R,2aS,8bS)-1-(hydroxymethyl)-2-[(3-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 54653365 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[(1R,2aS,8bS)-1-(hydroxymethyl)-2-[(3-methoxyphenyl)methyl]-1,2a,3,8b-tetrahydroazeto[2,3-c]quinolin-4-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | COc1cccc(CN2[C@@H]3CN(C(=O)CC(F)(F)F)c4ccccc4[C@@H]3[C@@H]2CO)c1 |
| InChI | InChI=1S/C22H23F3N2O3/c1-30-15-6-4-5-14(9-15)11-26-18-12-27(20(29)10-22(23,24)25)17-8-3-2-7-16(17)21(18)19(26)13-28/h2-9,18-19,21,28H,10-13H2,1H3/t18-,19+,21+/m1/s1 |
| InChIKey | NWDAXMAEIGIOJA-DYXWJJEUSA-N |
| XLogP | 3.32 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |