C24H24F2N2O6 — CID 54655363
methyl 2-[(2R,4aR,12aR)-8-[(3,4-difluorobenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate (PubChem CID 54655363) has the molecular formula C24H24F2N2O6 and a molecular weight of 474.46 g/mol. Its IUPAC name is methyl 2-[(2R,4aR,12aR)-8-[(3,4-difluorobenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4aR,12aR)-8-[(3,4-difluorobenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
|---|---|
| PubChem CID | 54655363 |
| Molecular Formula | C24H24F2N2O6 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | methyl 2-[(2R,4aR,12aR)-8-[(3,4-difluorobenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2[C@H](COc3ccc(NC(=O)c4ccc(F)c(F)c4)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C24H24F2N2O6/c1-28-19-7-5-15(11-22(29)32-2)34-21(19)12-33-20-8-4-14(10-16(20)24(28)31)27-23(30)13-3-6-17(25)18(26)9-13/h3-4,6,8-10,15,19,21H,5,7,11-12H2,1-2H3,(H,27,30)/t15-,19-,21+/m1/s1 |
| InChIKey | YSSOTBOETUWHJY-VMRPVKRXSA-N |
| XLogP | 3.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |