C25H28N2O7 — CID 54656273
methyl 2-[(2S,4aS,12aR)-8-[(3-methoxybenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate (PubChem CID 54656273) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is methyl 2-[(2S,4aS,12aR)-8-[(3-methoxybenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4aS,12aR)-8-[(3-methoxybenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
|---|---|
| PubChem CID | 54656273 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl 2-[(2S,4aS,12aR)-8-[(3-methoxybenzoyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC[C@H]2[C@H](COc3ccc(NC(=O)c4cccc(OC)c4)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C25H28N2O7/c1-27-20-9-8-18(13-23(28)32-3)34-22(20)14-33-21-10-7-16(12-19(21)25(27)30)26-24(29)15-5-4-6-17(11-15)31-2/h4-7,10-12,18,20,22H,8-9,13-14H2,1-3H3,(H,26,29)/t18-,20-,22-/m0/s1 |
| InChIKey | DXBWUUUJCKRXRZ-VCOUNFBDSA-N |
| XLogP | 2.89 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |