C25H26N4O6 — CID 54654772
methyl 2-[(2S,4aR,12aS)-8-[(3-cyanophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate (PubChem CID 54654772) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is methyl 2-[(2S,4aR,12aS)-8-[(3-cyanophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4aR,12aS)-8-[(3-cyanophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
|---|---|
| PubChem CID | 54654772 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | methyl 2-[(2S,4aR,12aS)-8-[(3-cyanophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC[C@@H]2[C@@H](COc3ccc(NC(=O)Nc4cccc(C#N)c4)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C25H26N4O6/c1-29-20-8-7-18(12-23(30)33-2)35-22(20)14-34-21-9-6-17(11-19(21)24(29)31)28-25(32)27-16-5-3-4-15(10-16)13-26/h3-6,9-11,18,20,22H,7-8,12,14H2,1-2H3,(H2,27,28,32)/t18-,20+,22+/m0/s1 |
| InChIKey | UPHQFLPMCJNZKA-CZTZKLFOSA-N |
| XLogP | 3.15 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |