C24H26ClN3O6 — CID 54656683
methyl 2-[(2S,4aR,12aS)-8-[(3-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate (PubChem CID 54656683) has the molecular formula C24H26ClN3O6 and a molecular weight of 487.94 g/mol. Its IUPAC name is methyl 2-[(2S,4aR,12aS)-8-[(3-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4aR,12aS)-8-[(3-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
|---|---|
| PubChem CID | 54656683 |
| Molecular Formula | C24H26ClN3O6 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl 2-[(2S,4aR,12aS)-8-[(3-chlorophenyl)carbamoylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC[C@@H]2[C@@H](COc3ccc(NC(=O)Nc4cccc(Cl)c4)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C24H26ClN3O6/c1-28-19-8-7-17(12-22(29)32-2)34-21(19)13-33-20-9-6-16(11-18(20)23(28)30)27-24(31)26-15-5-3-4-14(25)10-15/h3-6,9-11,17,19,21H,7-8,12-13H2,1-2H3,(H2,26,27,31)/t17-,19+,21+/m0/s1 |
| InChIKey | NIRVKPPWICYJRJ-FBBABVLZSA-N |
| XLogP | 3.93 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |