C23H32F2N2O4 — CID 54658363
2-[(3R,6aS,8S,10aS)-1-[(3,5-difluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-cyclopentylacetamide (PubChem CID 54658363) has the molecular formula C23H32F2N2O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-[(3R,6aS,8S,10aS)-1-[(3,5-difluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-cyclopentylacetamide.
| Compound Name | 2-[(3R,6aS,8S,10aS)-1-[(3,5-difluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 54658363 |
| Molecular Formula | C23H32F2N2O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[(3R,6aS,8S,10aS)-1-[(3,5-difluorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-cyclopentylacetamide |
| SMILES | O=C(C[C@@H]1CC[C@H]2[C@@H](COC[C@H](O)CN2Cc2cc(F)cc(F)c2)O1)NC1CCCC1 |
| InChI | InChI=1S/C23H32F2N2O4/c24-16-7-15(8-17(25)9-16)11-27-12-19(28)13-30-14-22-21(27)6-5-20(31-22)10-23(29)26-18-3-1-2-4-18/h7-9,18-22,28H,1-6,10-14H2,(H,26,29)/t19-,20+,21+,22-/m1/s1 |
| InChIKey | JOEKHTNVWLEBBB-CLAROIROSA-N |
| XLogP | 2.52 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |