C19H19N3O2S2 — CID 5465895
5-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4-dithione (PubChem CID 5465895) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4-dithione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4-dithione |
|---|---|
| PubChem CID | 5465895 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4-dithione |
| SMILES | COc1ccc(-c2c3c(nc4[nH]c(=S)[nH]c(=S)c24)CCCC3)cc1OC |
| InChI | InChI=1S/C19H19N3O2S2/c1-23-13-8-7-10(9-14(13)24-2)15-11-5-3-4-6-12(11)20-17-16(15)18(25)22-19(26)21-17/h7-9H,3-6H2,1-2H3,(H2,20,21,22,25,26) |
| InChIKey | ILCBMRHTPKAOIZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|