C22H31ClN2O5 — CID 54660075
2-[(3S,6aS,8R,10aS)-1-[(3-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone (PubChem CID 54660075) has the molecular formula C22H31ClN2O5 and a molecular weight of 438.95 g/mol. Its IUPAC name is 2-[(3S,6aS,8R,10aS)-1-[(3-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3S,6aS,8R,10aS)-1-[(3-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 54660075 |
| Molecular Formula | C22H31ClN2O5 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[(3S,6aS,8R,10aS)-1-[(3-chlorophenyl)methyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(C[C@H]1CC[C@H]2[C@@H](COC[C@@H](O)CN2Cc2cccc(Cl)c2)O1)N1CCOCC1 |
| InChI | InChI=1S/C22H31ClN2O5/c23-17-3-1-2-16(10-17)12-25-13-18(26)14-29-15-21-20(25)5-4-19(30-21)11-22(27)24-6-8-28-9-7-24/h1-3,10,18-21,26H,4-9,11-15H2/t18-,19+,20-,21+/m0/s1 |
| InChIKey | YFXNQPQEIIZQIH-JSXRDJHFSA-N |
| XLogP | 1.70 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |